Butyl acetate |
NO.142 |
| CH3CO2(CH2)3CH3(CH3CO2C4H9) |  |
 |
Performance
| Measuring Range | 0.05 to 0.8% |
| Number of Pump Strokes | 2 |
| Correction Factor | 1 |
| Sampling Time | 1.5 minutes per pump stroke |
| Detecting Limit | 0.002% (n=2) |
| Colour Change | Orange → Dark green |
| Reaction Principle | CH3CO2(CH2)3CH3 + Cr6+ H2SO4 → Cr3+ |
| Coefficient of Variation | 15% (for 0.01 to 0.2 %), 10% (for 0.2 to 0.8 %) |
| Shelf Life | 3 Years |
| Corrections for temperature & humidity | Temperature correction is necessary |
| Store the tubes at cool and dark place. | |
Possible coexisting substances and their interferences (NOTE)
| Substance | Concentration | Interference | Change colour by itself to |
| sulphur dioxide | 500 ppm | + | Green |
| Hydrogen sulphide | 500 ppm | + | Dark green |
| Alcohols, Esters, Ketones | + | Dark green | |
| Propane | 2000 ppm | + | Dark green (Whole layer) |
| Aromatic HCs | 500 ppm | + | Dark green |
| Calibration gas generation | Static gas dilution method |
| TLV-TWA | TLV-STEL | Explosive range |
| 150 ppm | 200 ppm | 1.7 to 7.6% |
