Butyl acetate |
NO.142L |
| CH3CO2(CH2)3CH3(CH3CO2C4H9) |  |
 |
Performance
| Measuring Range | 10 to 300 ppm |
| Number of Pump Strokes | 2 |
| Correction Factor | 1 |
| Sampling Time | 4 minutes per pump stroke |
| Detecting Limit | 2 ppm (n=2) |
| Colour Change | Yellow → Dark brown → Pale blue after few minutes |
| Reaction Principle | CH3CO2(CH2)3CH3 + Cr6+ + H2SO4 → Cr3+ |
| Coefficient of Variation | 15% (for 10 to 100 ppm), 10% (for 100 to 300 ppm) |
| Shelf Life | 2 Years |
| Corrections for temperature & humidity | Temperature correction is necessary |
| Store the tubes at cool and dark place. | |
Possible coexisting substances and their interferences (NOTE)
| Substance | Concentration | Interference | Change colour by itself to |
| Alcohols | + | Dark brown (few minutes later) → Pale blue | |
| Ketones | + | ||
| Esters | + | ||
| Aromatic HCs | + |
Other substance measurable with this detector tube
| Substance | Correction Factor | No. of pump strokes | Measuring Range |
| Isobuty Acrylate | Factor: 0.26 | 2 | 2.6 to 78 ppm |
| Butyl Acrylate | Factor: 0.7 | 2 | 7 to 210 ppm |
| Calibration gas generation | Diffusion tube method |
| TLV-TWA | TLV-STEL | Explosive range |
| 150 ppm | 200 ppm | 1.7 to 7.6% |
